| Latest revision |
Your text |
| Line 56: |
Line 56: |
| | | | |
| | Now if someone comes up with a species with the formula C<sub>2</sub>H, we know what to call it. Maybe the ion C<sup>-</sup>≡CH? [[User:Promethean|Promethean]] ([[User talk:Promethean|talk]]) | | Now if someone comes up with a species with the formula C<sub>2</sub>H, we know what to call it. Maybe the ion C<sup>-</sup>≡CH? [[User:Promethean|Promethean]] ([[User talk:Promethean|talk]]) |
| − |
| |
| − | I was never good at chemistry so this is probably a dumb question, but would it be possible to rename the elements to actually work with this convention? Obviously ignoring the fact that some elements may form too many bonds for any letters we have. [[User:Mikeb108|Mikeb108]] ([[User talk:Mikeb108|talk]]) 00:19, 10 February 2022 (UTC)
| |
| − | :Given the 26-letter alphabet, single-characted symbols could cover just 26 elements, possibly the following assignments...
| |
| − | :Valency 0: B,D,O
| |
| − | :Valency 1:P,Q
| |
| − | :Valency 2: A,C,G,I?,J?,L,M,N,R,S,U,V,W,Z
| |
| − | :Valency 3: E,F,J?,T,Y
| |
| − | :Valency 4: H,I?,K,X
| |
| − | :...question marks indicate characters in there twice, because of particular alternate font styles give very different results.
| |
| − | :Maybe something like the sharp points of the A, V, M, etc could be a bond-site. Or the bulges of B, R, etc, mean something.
| |
| − | :If digraph symbols are allowed (Uppercase+lowercase, to avoid confusion with compounds, no using of l (el) in that form if it looks too much like the initial I (ai)...), as currently, then maybe more coverage. Xo is another 4, as is Qh. While Oo is maybe another monatomic element?
| |
| − | :Going into punctuation, # (octothorn!) is actually overkill except perhaps to allow something like xenon octofluoride (I know it can do hexafluoride, but I think that's just tetrafluoride with extra fluorines in the two -Xe-F-F- loops - I really must check), but & would be an interesting two-bondsite (plus two of those lobes, if that works for ionic rather than covalent).
| |
| − | :The main problem is polyvalent elements, especially in the metals, like ferric (Fe<sup>3+</sup>) vs ferrous (Fe<sup>2+</sup>) vs ferrate (possibly Fe<sup>6+</sup>, but my knowledge of iron chemistry is... *ahem*... rusty!). What character(s) do we assign to those? Multiple optional diacritics, as required to achieve the desired modification?
| |
| − | :...I'm not saying it's not possible, but bond-types (there's at least three types to consider, depending on how you group them) and compatability with valid bond-angles (which really needs 3d glyphs with subtly different forms?) and then you end up with slvery similar forms between near-substitute elements that tend to be 'the same but slightly larger' in a bonding situation, etc.
| |
| − | :A less symbolic and more diagrammatic atomic illustration method might be easier to reuse as an alphabet, than the alphabet is to entirely reuse for diagrammatical purposes. But I'm sure with enough tweaking you could get something that works in limited ways. ;) [[Special:Contributions/172.70.91.126|172.70.91.126]] 01:31, 10 February 2022 (UTC)
| |
| − |
| |
| − | The hydrogen crystal in SMILES: <code>[H]1[H][H]23[H][H]4([H])[H][H]56[H]24[H]78[H]13[H][H]7([H])[H][H]58[H][H]6</code>. Unfortunately, some SMILES parsers can't handle overbonding. [[User:ClassicalGames|ClassicalGames]] ([[User talk:ClassicalGames|talk]]) 13:19, 20 April 2023 (UTC)
| |
| − |
| |
| − | :Carbon:<code>[C]=[C]</code>.
| |
| − | :The carbon compound is <code>[C]=[H]=[C]</code> and the oxygen is <code>[O].[O]</code>. See [[User:ChemistryGuide/SMILES|this page]] for the guide.
| |
| − | ::Don't remove the brackets, or it will not work. [[User:ChemistryGuide|ChemistryGuide]] ([[User talk:ChemistryGuide|talk]]) 07:02, 25 April 2023 (UTC)
| |
