Latest revision |
Your text |
Line 4: |
Line 4: |
| | | |
| What is the force that holds the two or three glyphs of an atom together called? How many bonds does the i's dot in Ti have? Ann how dangerous is comic sans cheMStry? [[Special:Contributions/141.101.104.39|141.101.104.39]] 06:52, 3 November 2014 (UTC) | | What is the force that holds the two or three glyphs of an atom together called? How many bonds does the i's dot in Ti have? Ann how dangerous is comic sans cheMStry? [[Special:Contributions/141.101.104.39|141.101.104.39]] 06:52, 3 November 2014 (UTC) |
− | :Probably not as dangerous as if you were using Aurebesh (look it up).--[[User:KitsunePhoenix|Amaroq (KitsunePhoenix)]] ([[User talk:KitsunePhoenix|talk]]) 03:15, 8 August 2021 (UTC)
| |
| :The letter i can only form one bond, as the other side is bonded with its dot. This is pretty basic chemestry![[User:Maplestrip|Maplestrip]] ([[User talk:Maplestrip|talk]]) 08:20, 3 November 2014 (UTC) | | :The letter i can only form one bond, as the other side is bonded with its dot. This is pretty basic chemestry![[User:Maplestrip|Maplestrip]] ([[User talk:Maplestrip|talk]]) 08:20, 3 November 2014 (UTC) |
| | | |
| ::Ok. Let's look at something advanced. Fe. Os. {{w|Ununtrium|Uut}}. -- [[User:Hkmaly|Hkmaly]] ([[User talk:Hkmaly|talk]]) 12:20, 3 November 2014 (UTC) | | ::Ok. Let's look at something advanced. Fe. Os. {{w|Ununtrium|Uut}}. -- [[User:Hkmaly|Hkmaly]] ([[User talk:Hkmaly|talk]]) 12:20, 3 November 2014 (UTC) |
− | :::Sorry, but you mean {{w|Nh|Nh}}.
| |
− | :::Ah, binary atoms. Probably too advanced for this discussion. [[User:Redbelly98|Redbelly98]] ([[User talk:Redbelly98|talk]]) 13:03, 21 July 2018 (UTC)
| |
| | | |
| Presumably hydrocarbon chains are still supported, albeit with hydrogens forming the backbone in a zip-like arrangement. You'd need phosphorous on the end, with a sans serif valence of 1. [[User:SleekWeasel|SleekWeasel]] ([[User talk:SleekWeasel|talk]]) 08:09, 3 November 2014 (UTC) | | Presumably hydrocarbon chains are still supported, albeit with hydrogens forming the backbone in a zip-like arrangement. You'd need phosphorous on the end, with a sans serif valence of 1. [[User:SleekWeasel|SleekWeasel]] ([[User talk:SleekWeasel|talk]]) 08:09, 3 November 2014 (UTC) |
Line 37: |
Line 34: |
| | | |
| Oxygen has 6 valence electrons, not two. It forms two bonds because it's got room for two more. [[Special:Contributions/108.162.216.105|108.162.216.105]] 16:49, 3 November 2014 (UTC) | | Oxygen has 6 valence electrons, not two. It forms two bonds because it's got room for two more. [[Special:Contributions/108.162.216.105|108.162.216.105]] 16:49, 3 November 2014 (UTC) |
− | :In a typographic chemistry system, assuming that molecules can still be 3-dimensional, Oxygen atoms could hypothetically find themselves strung along other atoms whose vertices poke through the O's (like a ring on a pole). If you were to throw quantum tunneling into the mix as well (probably represented by Stencil lettering), then you could have atoms passing through eachother, thus resulting in Oxygen forming into proper chain-links. --[[User:KitsunePhoenix|Amaroq (KitsunePhoenix)]] ([[User talk:KitsunePhoenix|talk]]) 03:15, 8 August 2021 (UTC)
| |
| | | |
| Could Mydrane be My Dr -ane where -ane is the common ending for an alkane. My Dr = CCH...which could be Cape Code Healthcare? ~~rbnm | | Could Mydrane be My Dr -ane where -ane is the common ending for an alkane. My Dr = CCH...which could be Cape Code Healthcare? ~~rbnm |
Line 54: |
Line 50: |
| Any idea why the title text says "usually" more reactive? Do we have examples of where serifs could be less reactive than their sans serif counterparts?[[Special:Contributions/108.162.229.90|108.162.229.90]] 11:51, 9 November 2014 (UTC) | | Any idea why the title text says "usually" more reactive? Do we have examples of where serifs could be less reactive than their sans serif counterparts?[[Special:Contributions/108.162.229.90|108.162.229.90]] 11:51, 9 November 2014 (UTC) |
| :Usually: For example, serif oxygen and sans-serif oxygen are both inert.[[Special:Contributions/199.27.133.126|199.27.133.126]] 23:45, 9 November 2014 (UTC) | | :Usually: For example, serif oxygen and sans-serif oxygen are both inert.[[Special:Contributions/199.27.133.126|199.27.133.126]] 23:45, 9 November 2014 (UTC) |
− |
| |
− | Now if someone comes up with a species with the formula C<sub>2</sub>H, we know what to call it. Maybe the ion C<sup>-</sup>≡CH? [[User:Promethean|Promethean]] ([[User talk:Promethean|talk]])
| |
− |
| |
− | I was never good at chemistry so this is probably a dumb question, but would it be possible to rename the elements to actually work with this convention? Obviously ignoring the fact that some elements may form too many bonds for any letters we have. [[User:Mikeb108|Mikeb108]] ([[User talk:Mikeb108|talk]]) 00:19, 10 February 2022 (UTC)
| |
− | :Given the 26-letter alphabet, single-characted symbols could cover just 26 elements, possibly the following assignments...
| |
− | :Valency 0: B,D,O
| |
− | :Valency 1:P,Q
| |
− | :Valency 2: A,C,G,I?,J?,L,M,N,R,S,U,V,W,Z
| |
− | :Valency 3: E,F,J?,T,Y
| |
− | :Valency 4: H,I?,K,X
| |
− | :...question marks indicate characters in there twice, because of particular alternate font styles give very different results.
| |
− | :Maybe something like the sharp points of the A, V, M, etc could be a bond-site. Or the bulges of B, R, etc, mean something.
| |
− | :If digraph symbols are allowed (Uppercase+lowercase, to avoid confusion with compounds, no using of l (el) in that form if it looks too much like the initial I (ai)...), as currently, then maybe more coverage. Xo is another 4, as is Qh. While Oo is maybe another monatomic element?
| |
− | :Going into punctuation, # (octothorn!) is actually overkill except perhaps to allow something like xenon octofluoride (I know it can do hexafluoride, but I think that's just tetrafluoride with extra fluorines in the two -Xe-F-F- loops - I really must check), but & would be an interesting two-bondsite (plus two of those lobes, if that works for ionic rather than covalent).
| |
− | :The main problem is polyvalent elements, especially in the metals, like ferric (Fe<sup>3+</sup>) vs ferrous (Fe<sup>2+</sup>) vs ferrate (possibly Fe<sup>6+</sup>, but my knowledge of iron chemistry is... *ahem*... rusty!). What character(s) do we assign to those? Multiple optional diacritics, as required to achieve the desired modification?
| |
− | :...I'm not saying it's not possible, but bond-types (there's at least three types to consider, depending on how you group them) and compatability with valid bond-angles (which really needs 3d glyphs with subtly different forms?) and then you end up with slvery similar forms between near-substitute elements that tend to be 'the same but slightly larger' in a bonding situation, etc.
| |
− | :A less symbolic and more diagrammatic atomic illustration method might be easier to reuse as an alphabet, than the alphabet is to entirely reuse for diagrammatical purposes. But I'm sure with enough tweaking you could get something that works in limited ways. ;) [[Special:Contributions/172.70.91.126|172.70.91.126]] 01:31, 10 February 2022 (UTC)
| |
− |
| |
− | The hydrogen crystal in SMILES: <code>[H]1[H][H]23[H][H]4([H])[H][H]56[H]24[H]78[H]13[H][H]7([H])[H][H]58[H][H]6</code>. Unfortunately, some SMILES parsers can't handle overbonding. [[User:ClassicalGames|ClassicalGames]] ([[User talk:ClassicalGames|talk]]) 13:19, 20 April 2023 (UTC)
| |
− |
| |
− | :Carbon:<code>[C]=[C]</code>.
| |
− | :The carbon compound is <code>[C]=[H]=[C]</code> and the oxygen is <code>[O].[O]</code>. See [[User:ChemistryGuide/SMILES|this page]] for the guide.
| |
− | ::Don't remove the brackets, or it will not work. [[User:ChemistryGuide|ChemistryGuide]] ([[User talk:ChemistryGuide|talk]]) 07:02, 25 April 2023 (UTC)
| |